C16H13F2N3O7 — CID 139620093
11-ethoxycarbonyl-6,7-difluoro-2-methyl-8-nitro-10-oxo-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-4-carboxylic acid (PubChem CID 139620093) has the molecular formula C16H13F2N3O7 and a molecular weight of 397.29 g/mol. Its IUPAC name is 11-ethoxycarbonyl-6,7-difluoro-2-methyl-8-nitro-10-oxo-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-4-carboxylic acid.
| Compound Name | 11-ethoxycarbonyl-6,7-difluoro-2-methyl-8-nitro-10-oxo-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-4-carboxylic acid |
|---|---|
| PubChem CID | 139620093 |
| Molecular Formula | C16H13F2N3O7 |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 11-ethoxycarbonyl-6,7-difluoro-2-methyl-8-nitro-10-oxo-1,2-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-4-carboxylic acid |
| SMILES | CCOC(=O)c1cn2c3c(c(F)c(F)c([N+](=O)[O-])c3c1=O)C(C(=O)O)CN2C |
| InChI | InChI=1S/C16H13F2N3O7/c1-3-28-16(25)7-5-20-12-8(6(15(23)24)4-19(20)2)10(17)11(18)13(21(26)27)9(12)14(7)22/h5-6H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | KWKNKOGPISSYPW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|