C17H12F4N2O6 — CID 139603809
prop-2-enyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 139603809) has the molecular formula C17H12F4N2O6 and a molecular weight of 416.28 g/mol. Its IUPAC name is prop-2-enyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | prop-2-enyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 139603809 |
| Molecular Formula | C17H12F4N2O6 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | prop-2-enyl 1-cyclopropyl-8-(difluoromethoxy)-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | C=CCOC(=O)c1cn(C2CC2)c2c(OC(F)F)c(F)c(F)c([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C17H12F4N2O6/c1-2-5-28-16(25)8-6-22(7-3-4-7)13-9(14(8)24)12(23(26)27)10(18)11(19)15(13)29-17(20)21/h2,6-7,17H,1,3-5H2 |
| InChIKey | KHZAXGSOTHZRNR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|