C30H28ClNO6 — CID 68695308
2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid (PubChem CID 68695308) has the molecular formula C30H28ClNO6 and a molecular weight of 534.01 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid.
| Compound Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68695308 |
| Molecular Formula | C30H28ClNO6 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-chlorophenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(CC(=O)O)c2cccc(/C=C/c3ccc(OCCCCOc4ccccc4Cl)cc3)c12 |
| InChI | InChI=1S/C30H28ClNO6/c31-25-7-1-2-9-27(25)38-17-4-3-16-37-24-14-11-21(12-15-24)10-13-22-6-5-8-26-30(22)23(18-28(33)34)19-32(26)20-29(35)36/h1-2,5-15,19H,3-4,16-18,20H2,(H,33,34)(H,35,36)/b13-10+ |
| InChIKey | PWGLSONOKLJXDJ-JLHYYAGUSA-N |
| XLogP | 6.41 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|