C33H35NO6 — CID 68691313
2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-propylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid (PubChem CID 68691313) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-propylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid.
| Compound Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-propylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68691313 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2-propylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
| SMILES | CCCc1ccccc1OCCCCOc1ccc(/C=C/c2cccc3c2c(CC(=O)O)cn3CC(=O)O)cc1 |
| InChI | InChI=1S/C33H35NO6/c1-2-8-25-9-3-4-12-30(25)40-20-6-5-19-39-28-17-14-24(15-18-28)13-16-26-10-7-11-29-33(26)27(21-31(35)36)22-34(29)23-32(37)38/h3-4,7,9-18,22H,2,5-6,8,19-21,23H2,1H3,(H,35,36)(H,37,38)/b16-13+ |
| InChIKey | YGUHOPCRIKHCAO-DTQAZKPQSA-N |
| XLogP | 6.71 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|