C32H34N6O4 — CID 59339565
4-[2-methyl-4-[[4-(4-phenylbutoxy)benzoyl]amino]-3-(2H-tetrazol-5-ylmethyl)indol-1-yl]butanoic acid (PubChem CID 59339565) has the molecular formula C32H34N6O4 and a molecular weight of 566.66 g/mol. Its IUPAC name is 4-[2-methyl-4-[[4-(4-phenylbutoxy)benzoyl]amino]-3-(2H-tetrazol-5-ylmethyl)indol-1-yl]butanoic acid.
| Compound Name | 4-[2-methyl-4-[[4-(4-phenylbutoxy)benzoyl]amino]-3-(2H-tetrazol-5-ylmethyl)indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 59339565 |
| Molecular Formula | C32H34N6O4 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 4-[2-methyl-4-[[4-(4-phenylbutoxy)benzoyl]amino]-3-(2H-tetrazol-5-ylmethyl)indol-1-yl]butanoic acid |
| SMILES | Cc1c(Cc2nn[nH]n2)c2c(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)cccc2n1CCCC(=O)O |
| InChI | InChI=1S/C32H34N6O4/c1-22-26(21-29-34-36-37-35-29)31-27(12-7-13-28(31)38(22)19-8-14-30(39)40)33-32(41)24-15-17-25(18-16-24)42-20-6-5-11-23-9-3-2-4-10-23/h2-4,7,9-10,12-13,15-18H,5-6,8,11,14,19-21H2,1H3,(H,33,41)(H,39,40)(H,34,35,36,37) |
| InChIKey | CXQGAJMTXGDDOC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|