C30H30N6O6 — CID 23124632
4-oxo-4-[7-[[4-(4-phenylbutoxy)benzoyl]amino]-2-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 23124632) has the molecular formula C30H30N6O6 and a molecular weight of 570.61 g/mol. Its IUPAC name is 4-oxo-4-[7-[[4-(4-phenylbutoxy)benzoyl]amino]-2-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-oxo-4-[7-[[4-(4-phenylbutoxy)benzoyl]amino]-2-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 23124632 |
| Molecular Formula | C30H30N6O6 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 4-oxo-4-[7-[[4-(4-phenylbutoxy)benzoyl]amino]-2-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | O=C(O)CCC(=O)N1CC(c2nn[nH]n2)Oc2cc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C30H30N6O6/c37-27(15-16-28(38)39)36-19-26(29-32-34-35-33-29)42-25-18-22(11-14-24(25)36)31-30(40)21-9-12-23(13-10-21)41-17-5-4-8-20-6-2-1-3-7-20/h1-3,6-7,9-14,18,26H,4-5,8,15-17,19H2,(H,31,40)(H,38,39)(H,32,33,34,35) |
| InChIKey | VCDLJJALEZKKBH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 159.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|