C27H23N5O4 — CID 87656853
N-[4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-N-(4-phenylbutoxy)benzamide (PubChem CID 87656853) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is N-[4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-N-(4-phenylbutoxy)benzamide.
| Compound Name | N-[4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-N-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 87656853 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-N-(4-phenylbutoxy)benzamide |
| SMILES | O=C(c1ccccc1)N(OCCCCc1ccccc1)c1cccc2c(=O)cc(-c3nn[nH]n3)oc12 |
| InChI | InChI=1S/C27H23N5O4/c33-23-18-24(26-28-30-31-29-26)36-25-21(23)15-9-16-22(25)32(27(34)20-13-5-2-6-14-20)35-17-8-7-12-19-10-3-1-4-11-19/h1-6,9-11,13-16,18H,7-8,12,17H2,(H,28,29,30,31) |
| InChIKey | RKIUQVCXSHUYRL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|