C14H20N4O — CID 124566909
(1R)-7-phenyl-1-(2H-tetrazol-5-yl)heptan-1-ol (PubChem CID 124566909) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is (1R)-7-phenyl-1-(2H-tetrazol-5-yl)heptan-1-ol.
| Compound Name | (1R)-7-phenyl-1-(2H-tetrazol-5-yl)heptan-1-ol |
|---|---|
| PubChem CID | 124566909 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (1R)-7-phenyl-1-(2H-tetrazol-5-yl)heptan-1-ol |
| SMILES | O[C@H](CCCCCCc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H20N4O/c19-13(14-15-17-18-16-14)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10,13,19H,1-2,4,7-8,11H2,(H,15,16,17,18)/t13-/m1/s1 |
| InChIKey | ZSPFISKDRLOPTJ-CYBMUJFWSA-N |
| XLogP | 2.43 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|