C22H26N4O — CID 70929168
1-[6-(6-amino-2-pyridinyl)pyridazin-3-yl]-7-phenylheptan-1-ol (PubChem CID 70929168) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-[6-(6-amino-2-pyridinyl)pyridazin-3-yl]-7-phenylheptan-1-ol.
| Compound Name | 1-[6-(6-amino-2-pyridinyl)pyridazin-3-yl]-7-phenylheptan-1-ol |
|---|---|
| PubChem CID | 70929168 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[6-(6-amino-2-pyridinyl)pyridazin-3-yl]-7-phenylheptan-1-ol |
| SMILES | Nc1cccc(-c2ccc(C(O)CCCCCCc3ccccc3)nn2)n1 |
| InChI | InChI=1S/C22H26N4O/c23-22-14-8-12-18(24-22)19-15-16-20(26-25-19)21(27)13-7-2-1-4-9-17-10-5-3-6-11-17/h3,5-6,8,10-12,14-16,21,27H,1-2,4,7,9,13H2,(H2,23,24) |
| InChIKey | CPUTVHAHSHXTCF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|