C24H25N3O3 — CID 24950528
methyl 6-[6-(7-phenylheptanoyl)pyridazin-3-yl]pyridine-2-carboxylate (PubChem CID 24950528) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 6-[6-(7-phenylheptanoyl)pyridazin-3-yl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[6-(7-phenylheptanoyl)pyridazin-3-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 24950528 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methyl 6-[6-(7-phenylheptanoyl)pyridazin-3-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(-c2ccc(C(=O)CCCCCCc3ccccc3)nn2)n1 |
| InChI | InChI=1S/C24H25N3O3/c1-30-24(29)22-14-9-13-19(25-22)20-16-17-21(27-26-20)23(28)15-8-3-2-5-10-18-11-6-4-7-12-18/h4,6-7,9,11-14,16-17H,2-3,5,8,10,15H2,1H3 |
| InChIKey | WWKFGEWOWBTGQA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|