C23H26N2O4 — CID 143530578
methyl 2-[2-(7-phenylheptanoyl)-4,5-dihydro-1,3-oxazol-5-yl]pyridine-4-carboxylate (PubChem CID 143530578) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 2-[2-(7-phenylheptanoyl)-4,5-dihydro-1,3-oxazol-5-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[2-(7-phenylheptanoyl)-4,5-dihydro-1,3-oxazol-5-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 143530578 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl 2-[2-(7-phenylheptanoyl)-4,5-dihydro-1,3-oxazol-5-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(C2CN=C(C(=O)CCCCCCc3ccccc3)O2)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-28-23(27)18-13-14-24-19(15-18)21-16-25-22(29-21)20(26)12-8-3-2-5-9-17-10-6-4-7-11-17/h4,6-7,10-11,13-15,21H,2-3,5,8-9,12,16H2,1H3 |
| InChIKey | DNOVFLHCUSFFFB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|