C32H33N3O6 — CID 56947480
methyl 3-[[4-[5-[[(2-oxo-8-phenyloctanoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]phenoxy]methyl]benzoate (PubChem CID 56947480) has the molecular formula C32H33N3O6 and a molecular weight of 555.63 g/mol. Its IUPAC name is methyl 3-[[4-[5-[[(2-oxo-8-phenyloctanoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]phenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[4-[5-[[(2-oxo-8-phenyloctanoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 56947480 |
| Molecular Formula | C32H33N3O6 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | methyl 3-[[4-[5-[[(2-oxo-8-phenyloctanoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccc(-c3nnc(CNC(=O)C(=O)CCCCCCc4ccccc4)o3)cc2)c1 |
| InChI | InChI=1S/C32H33N3O6/c1-39-32(38)26-14-9-13-24(20-26)22-40-27-18-16-25(17-19-27)31-35-34-29(41-31)21-33-30(37)28(36)15-8-3-2-5-10-23-11-6-4-7-12-23/h4,6-7,9,11-14,16-20H,2-3,5,8,10,15,21-22H2,1H3,(H,33,37) |
| InChIKey | QWYRZBKEAHIBGX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|