C26H35N3O2 — CID 21108907
N,N-dimethyl-3-[4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine (PubChem CID 21108907) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 21108907 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N,N-dimethyl-3-[4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2nnc(CCCCCCCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-29(2)20-11-21-30-24-18-16-23(17-19-24)26-28-27-25(31-26)15-10-5-3-4-7-12-22-13-8-6-9-14-22/h6,8-9,13-14,16-19H,3-5,7,10-12,15,20-21H2,1-2H3 |
| InChIKey | XEKDSUCZJVIQHQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|