C27H36N4O2 — CID 58884787
N-[3-(dimethylamino)propyl]-4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 58884787) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 58884787 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[5-(7-phenylheptyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2nnc(CCCCCCCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C27H36N4O2/c1-31(2)21-11-20-28-26(32)23-16-18-24(19-17-23)27-30-29-25(33-27)15-10-5-3-4-7-12-22-13-8-6-9-14-22/h6,8-9,13-14,16-19H,3-5,7,10-12,15,20-21H2,1-2H3,(H,28,32) |
| InChIKey | BKSDLCZCKWULBM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|