C25H27N3O4S — CID 21108916
N,N-dimethyl-3-[4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine (PubChem CID 21108916) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 21108916 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N,N-dimethyl-3-[4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2nnc(CS(=O)(=O)Cc3ccc4ccccc4c3)o2)cc1 |
| InChI | InChI=1S/C25H27N3O4S/c1-28(2)14-5-15-31-23-12-10-21(11-13-23)25-27-26-24(32-25)18-33(29,30)17-19-8-9-20-6-3-4-7-22(20)16-19/h3-4,6-13,16H,5,14-15,17-18H2,1-2H3 |
| InChIKey | MSVXUJTUCNPLGR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|