C20H16N2O4S — CID 135971504
4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 135971504) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenol.
| Compound Name | 4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135971504 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-[5-(naphthalen-2-ylmethylsulfonylmethyl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | O=S(=O)(Cc1ccc2ccccc2c1)Cc1nnc(-c2ccc(O)cc2)o1 |
| InChI | InChI=1S/C20H16N2O4S/c23-18-9-7-16(8-10-18)20-22-21-19(26-20)13-27(24,25)12-14-5-6-15-3-1-2-4-17(15)11-14/h1-11,23H,12-13H2 |
| InChIKey | RNPUYXSGZIGBMM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |