C20H23N3O — CID 44577785
2-(7-phenylheptyl)-5-pyridin-2-yl-1,3,4-oxadiazole (PubChem CID 44577785) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(7-phenylheptyl)-5-pyridin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-(7-phenylheptyl)-5-pyridin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 44577785 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-(7-phenylheptyl)-5-pyridin-2-yl-1,3,4-oxadiazole |
| SMILES | c1ccc(CCCCCCCc2nnc(-c3ccccn3)o2)cc1 |
| InChI | InChI=1S/C20H23N3O/c1(2-5-11-17-12-6-4-7-13-17)3-8-15-19-22-23-20(24-19)18-14-9-10-16-21-18/h4,6-7,9-10,12-14,16H,1-3,5,8,11,15H2 |
| InChIKey | CWUHAHJRIJENTA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|