C14H11N3O2S — CID 10401673
2-benzylsulfinyl-5-pyridin-2-yl-1,3,4-oxadiazole (PubChem CID 10401673) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-benzylsulfinyl-5-pyridin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfinyl-5-pyridin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 10401673 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-benzylsulfinyl-5-pyridin-2-yl-1,3,4-oxadiazole |
| SMILES | O=S(Cc1ccccc1)c1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C14H11N3O2S/c18-20(10-11-6-2-1-3-7-11)14-17-16-13(19-14)12-8-4-5-9-15-12/h1-9H,10H2 |
| InChIKey | LULNHCNTQCLIFT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |