C15H14N4O — CID 82020898
2-phenyl-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 82020898) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-phenyl-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine.
| Compound Name | 2-phenyl-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82020898 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-phenyl-2-(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | NCC(c1ccccc1)c1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C15H14N4O/c16-10-12(11-6-2-1-3-7-11)14-18-19-15(20-14)13-8-4-5-9-17-13/h1-9,12H,10,16H2 |
| InChIKey | QVMGEQWSEFFJOZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |