About 2-benzylsulfinylpyridine
2-benzylsulfinylpyridine (PubChem CID 13185049) has the molecular formula C12H11NOS
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-benzylsulfinylpyridine.
Molecular Properties
| Compound Name | 2-benzylsulfinylpyridine |
| PubChem CID | 13185049 |
| Molecular Formula | C12H11NOS |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-benzylsulfinylpyridine |
| SMILES | O=S(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C12H11NOS/c14-15(12-8-4-5-9-13-12)10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | VPRHBJYUMMVAHV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylsulfinylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfinylpyridine?
The IUPAC name of 2-benzylsulfinylpyridine (CID 13185049) is 2-benzylsulfinylpyridine.
What is the SMILES notation for 2-benzylsulfinylpyridine?
The canonical SMILES for 2-benzylsulfinylpyridine is O=S(Cc1ccccc1)c1ccccn1.
What is the InChIKey of 2-benzylsulfinylpyridine?
The InChIKey is VPRHBJYUMMVAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NOS/c14-15(12-8-4-5-9-13-12)10-11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of 2-benzylsulfinylpyridine?
2-benzylsulfinylpyridine has a molecular weight of 217.29 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfinylpyridine is sourced from PubChem (CID 13185049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).