C12H9Cl2NOS — CID 22764667
2-[(3,4-dichlorophenyl)methylsulfinyl]pyridine (PubChem CID 22764667) has the molecular formula C12H9Cl2NOS and a molecular weight of 286.18 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfinyl]pyridine.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfinyl]pyridine |
|---|---|
| PubChem CID | 22764667 |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfinyl]pyridine |
| SMILES | O=S(Cc1ccc(Cl)c(Cl)c1)c1ccccn1 |
| InChI | InChI=1S/C12H9Cl2NOS/c13-10-5-4-9(7-11(10)14)8-17(16)12-3-1-2-6-15-12/h1-7H,8H2 |
| InChIKey | WPZKLHAUFPIUPN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |