C25H25NO3 — CID 54443194
N-benzyl-2-oxo-5-(4-phenylmethoxyphenyl)pentanamide (PubChem CID 54443194) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-benzyl-2-oxo-5-(4-phenylmethoxyphenyl)pentanamide.
| Compound Name | N-benzyl-2-oxo-5-(4-phenylmethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 54443194 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-benzyl-2-oxo-5-(4-phenylmethoxyphenyl)pentanamide |
| SMILES | O=C(CCCc1ccc(OCc2ccccc2)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c27-24(25(28)26-18-21-8-3-1-4-9-21)13-7-12-20-14-16-23(17-15-20)29-19-22-10-5-2-6-11-22/h1-6,8-11,14-17H,7,12-13,18-19H2,(H,26,28) |
| InChIKey | WPPCSRINYSSESQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|