C16H20ClNO2 — CID 58369498
1-(4-chloro-1,3-oxazol-2-yl)-7-phenylheptan-1-ol (PubChem CID 58369498) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 1-(4-chloro-1,3-oxazol-2-yl)-7-phenylheptan-1-ol.
| Compound Name | 1-(4-chloro-1,3-oxazol-2-yl)-7-phenylheptan-1-ol |
|---|---|
| PubChem CID | 58369498 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(4-chloro-1,3-oxazol-2-yl)-7-phenylheptan-1-ol |
| SMILES | OC(CCCCCCc1ccccc1)c1nc(Cl)co1 |
| InChI | InChI=1S/C16H20ClNO2/c17-15-12-20-16(18-15)14(19)11-7-2-1-4-8-13-9-5-3-6-10-13/h3,5-6,9-10,12,14,19H,1-2,4,7-8,11H2 |
| InChIKey | MYCIZLAQZQDNAI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|