C17H20F3NO2 — CID 67300739
7-phenyl-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]heptan-1-ol (PubChem CID 67300739) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 7-phenyl-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]heptan-1-ol.
| Compound Name | 7-phenyl-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]heptan-1-ol |
|---|---|
| PubChem CID | 67300739 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 7-phenyl-1-[4-(trifluoromethyl)-1,3-oxazol-2-yl]heptan-1-ol |
| SMILES | OC(CCCCCCc1ccccc1)c1nc(C(F)(F)F)co1 |
| InChI | InChI=1S/C17H20F3NO2/c18-17(19,20)15-12-23-16(21-15)14(22)11-7-2-1-4-8-13-9-5-3-6-10-13/h3,5-6,9-10,12,14,22H,1-2,4,7-8,11H2 |
| InChIKey | ACFJOMGXIPCCKI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|