C18H20F3NO2 — CID 68990767
2,2,2-trifluoro-1-[2-(7-phenylheptyl)-1,3-oxazol-4-yl]ethanone (PubChem CID 68990767) has the molecular formula C18H20F3NO2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(7-phenylheptyl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-(7-phenylheptyl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 68990767 |
| Molecular Formula | C18H20F3NO2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(7-phenylheptyl)-1,3-oxazol-4-yl]ethanone |
| SMILES | O=C(c1coc(CCCCCCCc2ccccc2)n1)C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO2/c19-18(20,21)17(23)15-13-24-16(22-15)12-8-3-1-2-5-9-14-10-6-4-7-11-14/h4,6-7,10-11,13H,1-3,5,8-9,12H2 |
| InChIKey | OXVLYENHJBMJAM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|