C19H24N2O3 — CID 44554786
N,N-dimethyl-2-(7-phenylheptanoyl)-1,3-oxazole-4-carboxamide (PubChem CID 44554786) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N,N-dimethyl-2-(7-phenylheptanoyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N,N-dimethyl-2-(7-phenylheptanoyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 44554786 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N,N-dimethyl-2-(7-phenylheptanoyl)-1,3-oxazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1coc(C(=O)CCCCCCc2ccccc2)n1 |
| InChI | InChI=1S/C19H24N2O3/c1-21(2)19(23)16-14-24-18(20-16)17(22)13-9-4-3-6-10-15-11-7-5-8-12-15/h5,7-8,11-12,14H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | GKQXYZDHXNBGLV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|