C17H18N2O2 — CID 58369509
1-(4-isocyano-1,3-oxazol-2-yl)-7-phenylheptan-1-one (PubChem CID 58369509) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(4-isocyano-1,3-oxazol-2-yl)-7-phenylheptan-1-one.
| Compound Name | 1-(4-isocyano-1,3-oxazol-2-yl)-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 58369509 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-(4-isocyano-1,3-oxazol-2-yl)-7-phenylheptan-1-one |
| SMILES | [C-]#[N+]c1coc(C(=O)CCCCCCc2ccccc2)n1 |
| InChI | InChI=1S/C17H18N2O2/c1-18-16-13-21-17(19-16)15(20)12-8-3-2-5-9-14-10-6-4-7-11-14/h4,6-7,10-11,13H,2-3,5,8-9,12H2 |
| InChIKey | OGVXVLPFZHTVKQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|