C23H22N2O2 — CID 58956226
1-[5-(3-isocyanophenyl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one (PubChem CID 58956226) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[5-(3-isocyanophenyl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[5-(3-isocyanophenyl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 58956226 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[5-(3-isocyanophenyl)-1,3-oxazol-2-yl]-7-phenylheptan-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2cnc(C(=O)CCCCCCc3ccccc3)o2)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-24-20-14-9-13-19(16-20)22-17-25-23(27-22)21(26)15-8-3-2-5-10-18-11-6-4-7-12-18/h4,6-7,9,11-14,16-17H,2-3,5,8,10,15H2 |
| InChIKey | HYJVZYAEYFDJQY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|