C22H24N2O2 — CID 18138486
N-(4-phenylbutyl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 18138486) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(4-phenylbutyl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-(4-phenylbutyl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 18138486 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(4-phenylbutyl)-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2)o1)NCCCCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c25-21(23-16-8-7-11-18-9-3-1-4-10-18)14-15-22-24-17-20(26-22)19-12-5-2-6-13-19/h1-6,9-10,12-13,17H,7-8,11,14-16H2,(H,23,25) |
| InChIKey | CZKHRNYUJFBYNC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|