C17H22N2O4 — CID 86985390
N-[2-(2-methoxyethoxy)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 86985390) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 86985390 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | COCCOCCNC(=O)CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H22N2O4/c1-21-11-12-22-10-9-18-16(20)7-8-17-19-13-15(23-17)14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3,(H,18,20) |
| InChIKey | DABKJKKZGCGKTM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|