C16H23Cl2N3O2 — CID 119505974
N-[2-(ethylamino)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide;dihydrochloride (PubChem CID 119505974) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide;dihydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119505974 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide;dihydrochloride |
| SMILES | CCNCCNC(=O)CCc1ncc(-c2ccccc2)o1.Cl.Cl |
| InChI | InChI=1S/C16H21N3O2.2ClH/c1-2-17-10-11-18-15(20)8-9-16-19-12-14(21-16)13-6-4-3-5-7-13;;/h3-7,12,17H,2,8-11H2,1H3,(H,18,20);2*1H |
| InChIKey | UZDOAPKLWZSXHC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|