C14H16N2O2 — CID 47176259
N-[(5-phenyl-1,3-oxazol-2-yl)methyl]butanamide (PubChem CID 47176259) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[(5-phenyl-1,3-oxazol-2-yl)methyl]butanamide.
| Compound Name | N-[(5-phenyl-1,3-oxazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 47176259 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[(5-phenyl-1,3-oxazol-2-yl)methyl]butanamide |
| SMILES | CCCC(=O)NCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C14H16N2O2/c1-2-6-13(17)15-10-14-16-9-12(18-14)11-7-4-3-5-8-11/h3-5,7-9H,2,6,10H2,1H3,(H,15,17) |
| InChIKey | MKEPGPFDPULZOC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |