C16H20N2O3 — CID 43619774
2-methyl-2-[(5-phenyl-1,3-oxazol-2-yl)methylamino]pentanoic acid (PubChem CID 43619774) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-methyl-2-[(5-phenyl-1,3-oxazol-2-yl)methylamino]pentanoic acid.
| Compound Name | 2-methyl-2-[(5-phenyl-1,3-oxazol-2-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 43619774 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-methyl-2-[(5-phenyl-1,3-oxazol-2-yl)methylamino]pentanoic acid |
| SMILES | CCCC(C)(NCc1ncc(-c2ccccc2)o1)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-3-9-16(2,15(19)20)18-11-14-17-10-13(21-14)12-7-5-4-6-8-12/h4-8,10,18H,3,9,11H2,1-2H3,(H,19,20) |
| InChIKey | CHWPLHDHDASFKP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |