C19H27N3O2 — CID 86890674
1-(5,5-dimethylhexyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea (PubChem CID 86890674) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(5,5-dimethylhexyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea.
| Compound Name | 1-(5,5-dimethylhexyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 86890674 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(5,5-dimethylhexyl)-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea |
| SMILES | CC(C)(C)CCCCNC(=O)NCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,3)11-7-8-12-20-18(23)22-14-17-21-13-16(24-17)15-9-5-4-6-10-15/h4-6,9-10,13H,7-8,11-12,14H2,1-3H3,(H2,20,22,23) |
| InChIKey | JAIBZFJSQSAPMP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|