C18H22N4O3 — CID 51081529
1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea (PubChem CID 51081529) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 51081529 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[(5-phenyl-1,3-oxazol-2-yl)methyl]urea |
| SMILES | O=C(NCCCN1CCCC1=O)NCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H22N4O3/c23-17-8-4-10-22(17)11-5-9-19-18(24)21-13-16-20-12-15(25-16)14-6-2-1-3-7-14/h1-3,6-7,12H,4-5,8-11,13H2,(H2,19,21,24) |
| InChIKey | SEQSKLLDZIAFDZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|