C21H22N2O3 — CID 60565951
N-[(2-ethoxyphenyl)methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 60565951) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 60565951 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-3-(5-phenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | CCOc1ccccc1CNC(=O)CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-25-18-11-7-6-10-17(18)14-22-20(24)12-13-21-23-15-19(26-21)16-8-4-3-5-9-16/h3-11,15H,2,12-14H2,1H3,(H,22,24) |
| InChIKey | XETKBJKPJVHILX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |