C17H20N2O4S2 — CID 166422727
3-[2-[3-(5-phenyl-1,3-oxazol-2-yl)propanoylamino]ethyldisulfanyl]propanoic acid (PubChem CID 166422727) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[2-[3-(5-phenyl-1,3-oxazol-2-yl)propanoylamino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[3-(5-phenyl-1,3-oxazol-2-yl)propanoylamino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422727 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-[2-[3-(5-phenyl-1,3-oxazol-2-yl)propanoylamino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-15(18-9-11-25-24-10-8-17(21)22)6-7-16-19-12-14(23-16)13-4-2-1-3-5-13/h1-5,12H,6-11H2,(H,18,20)(H,21,22) |
| InChIKey | QPARZGZFUVGMGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|