C18H22N2O4 — CID 119235078
5-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoylamino]pentanoic acid (PubChem CID 119235078) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoylamino]pentanoic acid.
| Compound Name | 5-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119235078 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-[3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]propanoylamino]pentanoic acid |
| SMILES | Cc1ccc(-c2cnc(CCC(=O)NCCCCC(=O)O)o2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-13-5-7-14(8-6-13)15-12-20-17(24-15)10-9-16(21)19-11-3-2-4-18(22)23/h5-8,12H,2-4,9-11H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | CFTHCONRYNATQF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|