C22H31N3O2 — CID 35418539
3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide (PubChem CID 35418539) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide.
| Compound Name | 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 35418539 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide |
| SMILES | Cc1ccc(-c2cnc(CCC(=O)NCCCN3CCC(C)CC3)o2)cc1 |
| InChI | InChI=1S/C22H31N3O2/c1-17-4-6-19(7-5-17)20-16-24-22(27-20)9-8-21(26)23-12-3-13-25-14-10-18(2)11-15-25/h4-7,16,18H,3,8-15H2,1-2H3,(H,23,26) |
| InChIKey | QNGOZHQZINMKIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|