C20H28N4O2 — CID 119390880
4-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)butanamide (PubChem CID 119390880) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)butanamide.
| Compound Name | 4-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 119390880 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)butanamide |
| SMILES | O=C(CCCc1ncc(-c2ccccc2)o1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C20H28N4O2/c25-19(22-10-5-13-24-14-11-21-12-15-24)8-4-9-20-23-16-18(26-20)17-6-2-1-3-7-17/h1-3,6-7,16,21H,4-5,8-15H2,(H,22,25) |
| InChIKey | UPJWNYOYNKXFGD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|