C19H25N3O2 — CID 119533664
4-(5-phenyl-1,3-oxazol-2-yl)-N-(2-pyrrolidin-3-ylethyl)butanamide (PubChem CID 119533664) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-(5-phenyl-1,3-oxazol-2-yl)-N-(2-pyrrolidin-3-ylethyl)butanamide.
| Compound Name | 4-(5-phenyl-1,3-oxazol-2-yl)-N-(2-pyrrolidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119533664 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-(5-phenyl-1,3-oxazol-2-yl)-N-(2-pyrrolidin-3-ylethyl)butanamide |
| SMILES | O=C(CCCc1ncc(-c2ccccc2)o1)NCCC1CCNC1 |
| InChI | InChI=1S/C19H25N3O2/c23-18(21-12-10-15-9-11-20-13-15)7-4-8-19-22-14-17(24-19)16-5-2-1-3-6-16/h1-3,5-6,14-15,20H,4,7-13H2,(H,21,23) |
| InChIKey | RNKMHCLMCFJWKF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |