C19H28Cl2N4O2 — CID 119391777
3-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)propanamide;dihydrochloride (PubChem CID 119391777) has the molecular formula C19H28Cl2N4O2 and a molecular weight of 415.37 g/mol. Its IUPAC name is 3-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)propanamide;dihydrochloride.
| Compound Name | 3-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119391777 |
| Molecular Formula | C19H28Cl2N4O2 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-(5-phenyl-1,3-oxazol-2-yl)-N-(3-piperazin-1-ylpropyl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1ncc(-c2ccccc2)o1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C19H26N4O2.2ClH/c24-18(21-9-4-12-23-13-10-20-11-14-23)7-8-19-22-15-17(25-19)16-5-2-1-3-6-16;;/h1-3,5-6,15,20H,4,7-14H2,(H,21,24);2*1H |
| InChIKey | AGDGZGBWDGNZQT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|