C27H33N3O2 — CID 35418573
3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide (PubChem CID 35418573) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 35418573 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[3-(4-methylpiperidin-1-yl)propyl]propanamide |
| SMILES | CC1CCN(CCCNC(=O)CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C27H33N3O2/c1-21-15-19-30(20-16-21)18-8-17-28-24(31)13-14-25-29-26(22-9-4-2-5-10-22)27(32-25)23-11-6-3-7-12-23/h2-7,9-12,21H,8,13-20H2,1H3,(H,28,31) |
| InChIKey | CMBJSYIBFLHKJB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|