C26H23ClN2O2 — CID 46698863
N-[2-(3-chlorophenyl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 46698863) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 46698863 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccccc2)c(-c2ccccc2)o1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H23ClN2O2/c27-22-13-7-8-19(18-22)16-17-28-23(30)14-15-24-29-25(20-9-3-1-4-10-20)26(31-24)21-11-5-2-6-12-21/h1-13,18H,14-17H2,(H,28,30) |
| InChIKey | QOWLFLSPGCWJAG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |