C25H24N4O2 — CID 170459443
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide (PubChem CID 170459443) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 170459443 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanamide |
| SMILES | C#CCCC1(CCNC(=O)CCc2nc(-c3ccccc3)c(-c3ccccc3)o2)N=N1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-3-16-25(28-29-25)17-18-26-21(30)14-15-22-27-23(19-10-6-4-7-11-19)24(31-22)20-12-8-5-9-13-20/h1,4-13H,3,14-18H2,(H,26,30) |
| InChIKey | YRMVJTDVUOYZNS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|