C24H27N3O3 — CID 30534634
3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 30534634) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 30534634 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccccc2)c(-c2ccccc2)o1)NCCN1CCOCC1 |
| InChI | InChI=1S/C24H27N3O3/c28-21(25-13-14-27-15-17-29-18-16-27)11-12-22-26-23(19-7-3-1-4-8-19)24(30-22)20-9-5-2-6-10-20/h1-10H,11-18H2,(H,25,28) |
| InChIKey | GMZADGMRJZXEEO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |