C25H22N2O3 — CID 171679459
3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[(3-hydroxyphenyl)methyl]propanamide (PubChem CID 171679459) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[(3-hydroxyphenyl)methyl]propanamide.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[(3-hydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 171679459 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N-[(3-hydroxyphenyl)methyl]propanamide |
| SMILES | O=C(CCc1nc(-c2ccccc2)c(-c2ccccc2)o1)NCc1cccc(O)c1 |
| InChI | InChI=1S/C25H22N2O3/c28-21-13-7-8-18(16-21)17-26-22(29)14-15-23-27-24(19-9-3-1-4-10-19)25(30-23)20-11-5-2-6-12-20/h1-13,16,28H,14-15,17H2,(H,26,29) |
| InChIKey | NPFGLAICLNLEPD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |