C22H32N4O2 — CID 47888987
N-[4-(4-methylpiperidin-1-yl)butyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide (PubChem CID 47888987) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)butyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)butyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 47888987 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)butyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
| SMILES | CC1CCN(CCCCNC(=O)CCCc2nnc(-c3ccccc3)o2)CC1 |
| InChI | InChI=1S/C22H32N4O2/c1-18-12-16-26(17-13-18)15-6-5-14-23-20(27)10-7-11-21-24-25-22(28-21)19-8-3-2-4-9-19/h2-4,8-9,18H,5-7,10-17H2,1H3,(H,23,27) |
| InChIKey | IVTWQESCQORGMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|