C27H26N4O2S — CID 55691060
N-(3-phenothiazin-10-ylpropyl)-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide (PubChem CID 55691060) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-(3-phenothiazin-10-ylpropyl)-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide.
| Compound Name | N-(3-phenothiazin-10-ylpropyl)-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 55691060 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-(3-phenothiazin-10-ylpropyl)-4-(5-phenyl-1,3,4-oxadiazol-2-yl)butanamide |
| SMILES | O=C(CCCc1nnc(-c2ccccc2)o1)NCCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C27H26N4O2S/c32-25(16-8-17-26-29-30-27(33-26)20-10-2-1-3-11-20)28-18-9-19-31-21-12-4-6-14-23(21)34-24-15-7-5-13-22(24)31/h1-7,10-15H,8-9,16-19H2,(H,28,32) |
| InChIKey | WAAWFCURFRPUKB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|