About 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one
1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one (PubChem CID 122698292) has the molecular formula C23H20FN3O2
and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one.
Molecular Properties
| Compound Name | 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one |
| PubChem CID | 122698292 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one |
| SMILES | O=C(CCCCCc1ccncc1)c1nc2ncc(-c3ccccc3F)cc2o1 |
| InChI | InChI=1S/C23H20FN3O2/c24-19-8-5-4-7-18(19)17-14-21-22(26-15-17)27-23(29-21)20(28)9-3-1-2-6-16-10-12-25-13-11-16/h4-5,7-8,10-15H,1-3,6,9H2 |
| InChIKey | FQOHLEMKLHXNOI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one?
The IUPAC name of 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one (CID 122698292) is 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one.
What is the SMILES notation for 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one?
The canonical SMILES for 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one is O=C(CCCCCc1ccncc1)c1nc2ncc(-c3ccccc3F)cc2o1.
What is the InChIKey of 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one?
The InChIKey is FQOHLEMKLHXNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FN3O2/c24-19-8-5-4-7-18(19)17-14-21-22(26-15-17)27-23(29-21)20(28)9-3-1-2-6-16-10-12-25-13-11-16/h4-5,7-8,10-15H,1-3,6,9H2.
What are the key properties of 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one?
1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one has a molecular weight of 389.43 g/mol, XLogP of 5.41, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-fluorophenyl)-[1,3]oxazolo[4,5-b]pyridin-2-yl]-6-pyridin-4-ylhexan-1-one is sourced from PubChem (CID 122698292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).